Leucine (data page)
From Wikipedia, the free encyclopedia
The complete data for Leucine | ||||||||||||||||
General information Chemical formula: C6H13NO2
Molar mass: 131.18 g·mol-1 Systematic name: (S)-2-amino-4-methyl-pentanoic acid Abbreviations: L, Leu Synonyms: {(S)-/L-}2-amino-4-methylvaleric acid 4-methyl-norvaline α-aminoisocaproic acid |
||||||||||||||||
Database data | ||||||||||||||||
SMILES: CC(C)C[C@@H](C(=O)O)N [1] InChI=1/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/f/h8H [1]
|
||||||||||||||||
Physical properties | ||||||||||||||||
|
||||||||||||||||
Hazard properties | ||||||||||||||||
|
||||||||||||||||
Chemical properties | ||||||||||||||||
|
||||||||||||||||
Pharmacological properties | ||||||||||||||||
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
[edit] References
|