Arginine (data page)
From Wikipedia, the free encyclopedia
The complete data for Arginine | ||||||||||||||||
General information Chemical formula: C6H14N4O2
Molar mass: 174.2 g·mol-1 Systematic name: 2-amino-5-(diaminomethylidene amino)pentanoic acid Abbreviations: R, Arg Synonyms: 2-amino-5-guanidinopentanoic acid 2-amino-5-guanidinovaleric acid AIDS{-}121865 AIDS{-}159840 Argamine Arginin Argivene CHEBI:29016 CHEMBANK2983 Detoxargin Harg Levargin Minophagen A R-Gene |
||||||||||||||||
Database data | ||||||||||||||||
SMILES: NC(=N)NCCCC(N)C(=O)O InChI=1/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/f/h11H,8-9H2
|
||||||||||||||||
Physical properties | ||||||||||||||||
|
||||||||||||||||
Hazard properties | ||||||||||||||||
|
||||||||||||||||
Chemical properties | ||||||||||||||||
|
||||||||||||||||
Pharmacological properties | ||||||||||||||||
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
[edit] References
- a EINECS number 205-866-5 ((-)-D-arginine hydrate)
- a EINECS number 200-811-1 (for L-arginine)
- a CID 71070 from PubChem (D-arginine)
- a CID 6322 from PubChem (L-arginine)
|