Femoxetine
From Wikipedia, the free encyclopedia
| Femoxetine | |
|---|---|
 |
|
| IUPAC name | 4-cyclohexyl-3-[(4-methoxyphenoxy) methyl]-1-methylpiperidine |
| Identifiers | |
| CAS number | [59859-58-4] |
| PubChem | |
| SMILES | CN1CC[C@H]([C@@]3=CC=CC=C3)[C@@H](COC2=CC=C(OC)C=C2)C1 |
| Properties | |
| Molecular formula | C20H25NO2 |
| Molar mass | 311.418 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Femoxetine is a serotonin uptake inhibitor.
 |
This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |
