Dibenzylideneacetone
From Wikipedia, the free encyclopedia
| Dibenzylideneacetone | |
|---|---|
 |
|
 |
|
 |
|
| IUPAC name | 1,5-diphenylpenta-1,4-dien-3-one |
| Other names | Dibenzalacetone |
| Identifiers | |
| CAS number | [538-58-9] |
| SMILES | O=C(/C=C/c1ccccc1)/C=C/c2ccccc2 |
| Properties | |
| Molecular formula | C17H14O |
| Molar mass | 234.29 g/mol |
| Appearance | Yellow solid |
| Melting point |
110–112 °C (trans,trans isomer) |
| Solubility in water | Insoluble |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Dibenzylideneacetone or dibenzalacetone, often abbreviated dba, is an organic compound with the formula C17H14O. It is a bright yellow solid insoluble in water, but soluble in ethanol. Dibenzylideneacetone is used as a sunscreen component and it is used as a ligand in organometallic chemistry for instance in tris(dibenzylideneacetone)dipalladium(0). In this case, it is a labile ligand which is easily displaced by stronger ligands like triphenylphosphine, hence it serves a useful entry point into palladium(0) chemistry.
[edit] Preparation
The compound can be prepared in the laboratory by an aldol condensation of benzaldehyde and acetone with sodium hydroxide in a water / ethanol medium with the exclusive formation of the trans,trans isomer (melting point 110–111 °C).[1]
This reaction is frequently encountered in organic chemistry education as a laboratory procedure. The conversion proceeds via the intermediacy of benzylideneacetone.
Prolonged exposure to sunlight converts the compound in a [2+2] cycloaddition to a mixture of four cyclobutane isomers.[2]
[edit] References
- ^ Conard, C. R.; Dolliver, M. A. (1943). "Dibenzalacetone". Org. Synth.; Coll. Vol. 2: 167.
- ^ Rao, G. N.; Janardhana, C.; Ramanathan, V.; Rajesh, T.; Kumar, P. H. (November 2006). "Photochemical Dimerization of Dibenzylideneacetone. A Convenient Exercise in [2+2] Cycloaddition Using Chemical Ionization Mass Spectrometry". J. Chem. Educ. 83 (11): 1667.
