Dapagliflozin
From Wikipedia, the free encyclopedia
| Dapagliflozin | |
|---|---|
 |
|
| IUPAC name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-(4-ethoxybenzyl)phenyl]-6- (hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol |
| Other names | BMS-512148
(1S)-1,5-anhydro-1-C-{4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl}-D-glucitol |
| Identifiers | |
| CAS number | [461432-26-8] |
| SMILES | [H][C@]1(O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c2cc(Cc3ccc(OCC)cc3)c(Cl)cc2 |
| InChI | 1/C21H25ClO6/c1-2-27- 15-6-3-12(4-7-15)9- 14-10-13(5-8-16(14)22)21- 20(26)19(25)18(24)17(11- 23)28-21/h3-8,10,17-21, 23-26H,2,9,11H2,1H3/t17-, 18-,19+,20-,21+/m1/s1 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Dapagliflozin (rINN/USAN) is an experimental SGLT2 inhibitor being studied by Bristol-Myers Squibb as a potential treatment for type 1 and 2 diabetes.[1]
[edit] References
 |
This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |
|
||||||||||||||||||||||||||||||||||||||
