SKF 38393
From Wikipedia, the free encyclopedia
| SKF 38393 | |
|---|---|
 |
|
| IUPAC name | 1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol |
| Identifiers | |
| CAS number | [67287-49-4] |
| PubChem | |
| SMILES | C1CNCC(C2=CC(=C(C=C21)O)O)C3=CC=CC=C3 |
| Properties | |
| Molecular formula | C16H17NO2 |
| Molar mass | 255.31168 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
SKF 38393 is a synthetic compound that acts as a dopamine D1 receptor agonist. The abbreviation SKF stands for Smith Kline and French, a pharmaceutical company which later became GlaxoSmithKline. SKF 38393 is used primarily as a research tool. It is commonly sold as the hydrochloride salt.
[edit] External links
Commercial supplier of SKF 38393
|
||||||||||||||||||||
 |
This article about a heterocyclic compound is a stub. You can help Wikipedia by expanding it. |
 |
This molecular or cell biology article is a stub. You can help Wikipedia by expanding it. |
 |
This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |
